C23H27N3O4S2 — CID 59537578
2-[(2-amino-1,2-diphenylethyl)sulfamoylmethyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 59537578) has the molecular formula C23H27N3O4S2 and a molecular weight of 473.62 g/mol. Its IUPAC name is 2-[(2-amino-1,2-diphenylethyl)sulfamoylmethyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 2-[(2-amino-1,2-diphenylethyl)sulfamoylmethyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 59537578 |
| Molecular Formula | C23H27N3O4S2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 2-[(2-amino-1,2-diphenylethyl)sulfamoylmethyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccccc1CS(=O)(=O)NC(c1ccccc1)C(N)c1ccccc1 |
| InChI | InChI=1S/C23H27N3O4S2/c1-26(2)32(29,30)21-16-10-9-15-20(21)17-31(27,28)25-23(19-13-7-4-8-14-19)22(24)18-11-5-3-6-12-18/h3-16,22-23,25H,17,24H2,1-2H3 |
| InChIKey | XXQOOELFJSGNDN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |