C12H16N2O6S — CID 104934781
(2S)-2-[(2-nitrophenyl)methylsulfonylamino]pentanoic acid (PubChem CID 104934781) has the molecular formula C12H16N2O6S and a molecular weight of 316.33 g/mol. Its IUPAC name is (2S)-2-[(2-nitrophenyl)methylsulfonylamino]pentanoic acid.
| Compound Name | (2S)-2-[(2-nitrophenyl)methylsulfonylamino]pentanoic acid |
|---|---|
| PubChem CID | 104934781 |
| Molecular Formula | C12H16N2O6S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | (2S)-2-[(2-nitrophenyl)methylsulfonylamino]pentanoic acid |
| SMILES | CCC[C@H](NS(=O)(=O)Cc1ccccc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C12H16N2O6S/c1-2-5-10(12(15)16)13-21(19,20)8-9-6-3-4-7-11(9)14(17)18/h3-4,6-7,10,13H,2,5,8H2,1H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | UDZRPTPIWUXTDT-JTQLQIEISA-N |
| XLogP | 1.27 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|