C12H24N2O5S — CID 43470083
2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]hexanoic acid (PubChem CID 43470083) has the molecular formula C12H24N2O5S and a molecular weight of 308.40 g/mol. Its IUPAC name is 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]hexanoic acid.
| Compound Name | 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]hexanoic acid |
|---|---|
| PubChem CID | 43470083 |
| Molecular Formula | C12H24N2O5S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]hexanoic acid |
| SMILES | CCCCC(NS(=O)(=O)N1CC(C)OC(C)C1)C(=O)O |
| InChI | InChI=1S/C12H24N2O5S/c1-4-5-6-11(12(15)16)13-20(17,18)14-7-9(2)19-10(3)8-14/h9-11,13H,4-8H2,1-3H3,(H,15,16) |
| InChIKey | FJPJIRFBOLILDD-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |