C14H21N3O4S — CID 100851411
(2R)-2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylamino]-2-phenylacetamide (PubChem CID 100851411) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is (2R)-2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylamino]-2-phenylacetamide.
| Compound Name | (2R)-2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 100851411 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (2R)-2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylamino]-2-phenylacetamide |
| SMILES | C[C@@H]1CN(S(=O)(=O)N[C@@H](C(N)=O)c2ccccc2)C[C@@H](C)O1 |
| InChI | InChI=1S/C14H21N3O4S/c1-10-8-17(9-11(2)21-10)22(19,20)16-13(14(15)18)12-6-4-3-5-7-12/h3-7,10-11,13,16H,8-9H2,1-2H3,(H2,15,18)/t10-,11-,13-/m1/s1 |
| InChIKey | GDGCUIKSBOHGRO-NQBHXWOUSA-N |
| XLogP | 0.16 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |