C14H20N2O2 — CID 92787390
(2R)-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-phenylacetamide (PubChem CID 92787390) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is (2R)-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-phenylacetamide.
| Compound Name | (2R)-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 92787390 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | (2R)-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-phenylacetamide |
| SMILES | C[C@@H]1CN([C@@H](C(N)=O)c2ccccc2)C[C@@H](C)O1 |
| InChI | InChI=1S/C14H20N2O2/c1-10-8-16(9-11(2)18-10)13(14(15)17)12-6-4-3-5-7-12/h3-7,10-11,13H,8-9H2,1-2H3,(H2,15,17)/t10-,11-,13-/m1/s1 |
| InChIKey | DVXKHGUBWPDDAM-NQBHXWOUSA-N |
| XLogP | 1.32 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |