C21H24N2O5 — CID 4974400
5-[[2-(2,6-dimethylmorpholin-4-yl)-2-phenylacetyl]amino]-2-hydroxybenzoic acid (PubChem CID 4974400) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is 5-[[2-(2,6-dimethylmorpholin-4-yl)-2-phenylacetyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[2-(2,6-dimethylmorpholin-4-yl)-2-phenylacetyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 4974400 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 5-[[2-(2,6-dimethylmorpholin-4-yl)-2-phenylacetyl]amino]-2-hydroxybenzoic acid |
| SMILES | CC1CN(C(C(=O)Nc2ccc(O)c(C(=O)O)c2)c2ccccc2)CC(C)O1 |
| InChI | InChI=1S/C21H24N2O5/c1-13-11-23(12-14(2)28-13)19(15-6-4-3-5-7-15)20(25)22-16-8-9-18(24)17(10-16)21(26)27/h3-10,13-14,19,24H,11-12H2,1-2H3,(H,22,25)(H,26,27) |
| InChIKey | ZSGPGLOJJRSFQZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|