C19H20N2O4 — CID 136557404
5-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propanoylamino]-2-hydroxybenzoic acid (PubChem CID 136557404) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 5-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propanoylamino]-2-hydroxybenzoic acid.
| Compound Name | 5-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propanoylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 136557404 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 5-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propanoylamino]-2-hydroxybenzoic acid |
| SMILES | CC(C(=O)Nc1ccc(O)c(C(=O)O)c1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H20N2O4/c1-12(21-9-8-13-4-2-3-5-14(13)11-21)18(23)20-15-6-7-17(22)16(10-15)19(24)25/h2-7,10,12,22H,8-9,11H2,1H3,(H,20,23)(H,24,25) |
| InChIKey | CFATULABQYHCFB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|