C21H25ClN2O2 — CID 2419129
(2R)-N-(3-chloro-4-methoxyphenyl)-2-[(3S)-3-methylpiperidin-1-yl]-2-phenylacetamide (PubChem CID 2419129) has the molecular formula C21H25ClN2O2 and a molecular weight of 372.90 g/mol. Its IUPAC name is (2R)-N-(3-chloro-4-methoxyphenyl)-2-[(3S)-3-methylpiperidin-1-yl]-2-phenylacetamide.
| Compound Name | (2R)-N-(3-chloro-4-methoxyphenyl)-2-[(3S)-3-methylpiperidin-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 2419129 |
| Molecular Formula | C21H25ClN2O2 |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (2R)-N-(3-chloro-4-methoxyphenyl)-2-[(3S)-3-methylpiperidin-1-yl]-2-phenylacetamide |
| SMILES | COc1ccc(NC(=O)[C@@H](c2ccccc2)N2CCC[C@H](C)C2)cc1Cl |
| InChI | InChI=1S/C21H25ClN2O2/c1-15-7-6-12-24(14-15)20(16-8-4-3-5-9-16)21(25)23-17-10-11-19(26-2)18(22)13-17/h3-5,8-11,13,15,20H,6-7,12,14H2,1-2H3,(H,23,25)/t15-,20+/m0/s1 |
| InChIKey | VVLRHHWLHILNTA-MGPUTAFESA-N |
| XLogP | 4.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |