C24H30ClN3O2 — CID 78899528
N-(3-chloro-4-methoxyphenyl)-2-phenyl-2-(4-pyrrolidin-1-ylpiperidin-1-yl)acetamide (PubChem CID 78899528) has the molecular formula C24H30ClN3O2 and a molecular weight of 427.98 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-phenyl-2-(4-pyrrolidin-1-ylpiperidin-1-yl)acetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-phenyl-2-(4-pyrrolidin-1-ylpiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 78899528 |
| Molecular Formula | C24H30ClN3O2 |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-phenyl-2-(4-pyrrolidin-1-ylpiperidin-1-yl)acetamide |
| SMILES | COc1ccc(NC(=O)C(c2ccccc2)N2CCC(N3CCCC3)CC2)cc1Cl |
| InChI | InChI=1S/C24H30ClN3O2/c1-30-22-10-9-19(17-21(22)25)26-24(29)23(18-7-3-2-4-8-18)28-15-11-20(12-16-28)27-13-5-6-14-27/h2-4,7-10,17,20,23H,5-6,11-16H2,1H3,(H,26,29) |
| InChIKey | DUZRMFIXZOKLCN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |