C25H27ClN4O2 — CID 55470928
N-(3-chloro-4-methoxyphenyl)-2-phenyl-2-[4-(pyridin-2-ylmethyl)piperazin-1-yl]acetamide (PubChem CID 55470928) has the molecular formula C25H27ClN4O2 and a molecular weight of 450.97 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-phenyl-2-[4-(pyridin-2-ylmethyl)piperazin-1-yl]acetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-phenyl-2-[4-(pyridin-2-ylmethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55470928 |
| Molecular Formula | C25H27ClN4O2 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-phenyl-2-[4-(pyridin-2-ylmethyl)piperazin-1-yl]acetamide |
| SMILES | COc1ccc(NC(=O)C(c2ccccc2)N2CCN(Cc3ccccn3)CC2)cc1Cl |
| InChI | InChI=1S/C25H27ClN4O2/c1-32-23-11-10-20(17-22(23)26)28-25(31)24(19-7-3-2-4-8-19)30-15-13-29(14-16-30)18-21-9-5-6-12-27-21/h2-12,17,24H,13-16,18H2,1H3,(H,28,31) |
| InChIKey | GUOVYZDHMLNIQV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |