C8H19N3O3S — CID 43603513
N-(2-aminoethyl)-2,6-dimethylmorpholine-4-sulfonamide (PubChem CID 43603513) has the molecular formula C8H19N3O3S and a molecular weight of 237.32 g/mol. Its IUPAC name is N-(2-aminoethyl)-2,6-dimethylmorpholine-4-sulfonamide.
| Compound Name | N-(2-aminoethyl)-2,6-dimethylmorpholine-4-sulfonamide |
|---|---|
| PubChem CID | 43603513 |
| Molecular Formula | C8H19N3O3S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | N-(2-aminoethyl)-2,6-dimethylmorpholine-4-sulfonamide |
| SMILES | CC1CN(S(=O)(=O)NCCN)CC(C)O1 |
| InChI | InChI=1S/C8H19N3O3S/c1-7-5-11(6-8(2)14-7)15(12,13)10-4-3-9/h7-8,10H,3-6,9H2,1-2H3 |
| InChIKey | XZZIKRHVVPDQCP-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |