C14H24ClN3O3S — CID 120715648
N-[2-(4-aminophenyl)ethyl]-2,6-dimethylmorpholine-4-sulfonamide;hydrochloride (PubChem CID 120715648) has the molecular formula C14H24ClN3O3S and a molecular weight of 349.88 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-2,6-dimethylmorpholine-4-sulfonamide;hydrochloride.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-2,6-dimethylmorpholine-4-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120715648 |
| Molecular Formula | C14H24ClN3O3S |
| Molecular Weight | 349.88 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-2,6-dimethylmorpholine-4-sulfonamide;hydrochloride |
| SMILES | CC1CN(S(=O)(=O)NCCc2ccc(N)cc2)CC(C)O1.Cl |
| InChI | InChI=1S/C14H23N3O3S.ClH/c1-11-9-17(10-12(2)20-11)21(18,19)16-8-7-13-3-5-14(15)6-4-13;/h3-6,11-12,16H,7-10,15H2,1-2H3;1H |
| InChIKey | KGBDFCWTURHBNY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.88 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|