C19H32N4O3S — CID 51725042
(2S,6S)-2,6-dimethyl-N-[3-(4-phenylpiperazin-1-yl)propyl]morpholine-4-sulfonamide (PubChem CID 51725042) has the molecular formula C19H32N4O3S and a molecular weight of 396.56 g/mol. Its IUPAC name is (2S,6S)-2,6-dimethyl-N-[3-(4-phenylpiperazin-1-yl)propyl]morpholine-4-sulfonamide.
| Compound Name | (2S,6S)-2,6-dimethyl-N-[3-(4-phenylpiperazin-1-yl)propyl]morpholine-4-sulfonamide |
|---|---|
| PubChem CID | 51725042 |
| Molecular Formula | C19H32N4O3S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | (2S,6S)-2,6-dimethyl-N-[3-(4-phenylpiperazin-1-yl)propyl]morpholine-4-sulfonamide |
| SMILES | C[C@H]1CN(S(=O)(=O)NCCCN2CCN(c3ccccc3)CC2)C[C@H](C)O1 |
| InChI | InChI=1S/C19H32N4O3S/c1-17-15-23(16-18(2)26-17)27(24,25)20-9-6-10-21-11-13-22(14-12-21)19-7-4-3-5-8-19/h3-5,7-8,17-18,20H,6,9-16H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | OIFAMEHDCYHMSW-ROUUACIJSA-N |
| XLogP | 1.14 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|