C18H30N4O2S — CID 51939583
(3R)-3-methyl-N-[2-(4-phenylpiperazin-1-yl)ethyl]piperidine-1-sulfonamide (PubChem CID 51939583) has the molecular formula C18H30N4O2S and a molecular weight of 366.53 g/mol. Its IUPAC name is (3R)-3-methyl-N-[2-(4-phenylpiperazin-1-yl)ethyl]piperidine-1-sulfonamide.
| Compound Name | (3R)-3-methyl-N-[2-(4-phenylpiperazin-1-yl)ethyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 51939583 |
| Molecular Formula | C18H30N4O2S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | (3R)-3-methyl-N-[2-(4-phenylpiperazin-1-yl)ethyl]piperidine-1-sulfonamide |
| SMILES | C[C@@H]1CCCN(S(=O)(=O)NCCN2CCN(c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C18H30N4O2S/c1-17-6-5-10-22(16-17)25(23,24)19-9-11-20-12-14-21(15-13-20)18-7-3-2-4-8-18/h2-4,7-8,17,19H,5-6,9-16H2,1H3/t17-/m1/s1 |
| InChIKey | HJEIPEYTPIBFLN-QGZVFWFLSA-N |
| XLogP | 1.37 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |