C11H19ClN2O4S2 — CID 120715601
N-[2-(4-aminophenyl)ethyl]-2-methylsulfonylethanesulfonamide;hydrochloride (PubChem CID 120715601) has the molecular formula C11H19ClN2O4S2 and a molecular weight of 342.87 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-2-methylsulfonylethanesulfonamide;hydrochloride.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-2-methylsulfonylethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120715601 |
| Molecular Formula | C11H19ClN2O4S2 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-2-methylsulfonylethanesulfonamide;hydrochloride |
| SMILES | CS(=O)(=O)CCS(=O)(=O)NCCc1ccc(N)cc1.Cl |
| InChI | InChI=1S/C11H18N2O4S2.ClH/c1-18(14,15)8-9-19(16,17)13-7-6-10-2-4-11(12)5-3-10;/h2-5,13H,6-9,12H2,1H3;1H |
| InChIKey | NAZGZTVEVXWPIA-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|