C12H19NO4S2 — CID 110790721
N-[2-(4-ethylsulfonylphenyl)ethyl]ethanesulfonamide (PubChem CID 110790721) has the molecular formula C12H19NO4S2 and a molecular weight of 305.42 g/mol. Its IUPAC name is N-[2-(4-ethylsulfonylphenyl)ethyl]ethanesulfonamide.
| Compound Name | N-[2-(4-ethylsulfonylphenyl)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 110790721 |
| Molecular Formula | C12H19NO4S2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | N-[2-(4-ethylsulfonylphenyl)ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCc1ccc(S(=O)(=O)CC)cc1 |
| InChI | InChI=1S/C12H19NO4S2/c1-3-18(14,15)12-7-5-11(6-8-12)9-10-13-19(16,17)4-2/h5-8,13H,3-4,9-10H2,1-2H3 |
| InChIKey | WLMAZHBIKOIXMJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |