C15H23NO4S2 — CID 110790741
N-[2-(4-cyclopentylsulfonylphenyl)ethyl]ethanesulfonamide (PubChem CID 110790741) has the molecular formula C15H23NO4S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is N-[2-(4-cyclopentylsulfonylphenyl)ethyl]ethanesulfonamide.
| Compound Name | N-[2-(4-cyclopentylsulfonylphenyl)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 110790741 |
| Molecular Formula | C15H23NO4S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-[2-(4-cyclopentylsulfonylphenyl)ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCc1ccc(S(=O)(=O)C2CCCC2)cc1 |
| InChI | InChI=1S/C15H23NO4S2/c1-2-21(17,18)16-12-11-13-7-9-15(10-8-13)22(19,20)14-5-3-4-6-14/h7-10,14,16H,2-6,11-12H2,1H3 |
| InChIKey | VWBRPFJQTOLXHJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |