About 4-[5-(4-aminophenyl)pentyl]aniline;methanesulfonic acid
4-[5-(4-aminophenyl)pentyl]aniline;methanesulfonic acid (PubChem CID 24833754) has the molecular formula C19H30N2O6S2
and a molecular weight of 446.59 g/mol. Its IUPAC name is 4-[5-(4-aminophenyl)pentyl]aniline;methanesulfonic acid.
Molecular Properties
| Compound Name | 4-[5-(4-aminophenyl)pentyl]aniline;methanesulfonic acid |
| PubChem CID | 24833754 |
| Molecular Formula | C19H30N2O6S2 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 4-[5-(4-aminophenyl)pentyl]aniline;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.Nc1ccc(CCCCCc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C17H22N2.2CH4O3S/c18-16-10-6-14(7-11-16)4-2-1-3-5-15-8-12-17(19)13-9-15;2*1-5(2,3)4/h6-13H,1-5,18-19H2;2*1H3,(H,2,3,4) |
| InChIKey | HXWOSLTVJKHWAR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-(4-aminophenyl)pentyl]aniline;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(4-aminophenyl)pentyl]aniline;methanesulfonic acid?
The IUPAC name of 4-[5-(4-aminophenyl)pentyl]aniline;methanesulfonic acid (CID 24833754) is 4-[5-(4-aminophenyl)pentyl]aniline;methanesulfonic acid.
What is the SMILES notation for 4-[5-(4-aminophenyl)pentyl]aniline;methanesulfonic acid?
The canonical SMILES for 4-[5-(4-aminophenyl)pentyl]aniline;methanesulfonic acid is CS(=O)(=O)O.CS(=O)(=O)O.Nc1ccc(CCCCCc2ccc(N)cc2)cc1.
What is the InChIKey of 4-[5-(4-aminophenyl)pentyl]aniline;methanesulfonic acid?
The InChIKey is HXWOSLTVJKHWAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2.2CH4O3S/c18-16-10-6-14(7-11-16)4-2-1-3-5-15-8-12-17(19)13-9-15;2*1-5(2,3)4/h6-13H,1-5,18-19H2;2*1H3,(H,2,3,4).
What are the key properties of 4-[5-(4-aminophenyl)pentyl]aniline;methanesulfonic acid?
4-[5-(4-aminophenyl)pentyl]aniline;methanesulfonic acid has a molecular weight of 446.59 g/mol, XLogP of 2.81, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(4-aminophenyl)pentyl]aniline;methanesulfonic acid is sourced from PubChem (CID 24833754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).