C16H21N3 — CID 58212339
4-N-[4-(4-aminophenyl)butyl]benzene-1,4-diamine (PubChem CID 58212339) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is 4-N-[4-(4-aminophenyl)butyl]benzene-1,4-diamine.
| Compound Name | 4-N-[4-(4-aminophenyl)butyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 58212339 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 4-N-[4-(4-aminophenyl)butyl]benzene-1,4-diamine |
| SMILES | Nc1ccc(CCCCNc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C16H21N3/c17-14-6-4-13(5-7-14)3-1-2-12-19-16-10-8-15(18)9-11-16/h4-11,19H,1-3,12,17-18H2 |
| InChIKey | BQHISDJFZBZNRI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|