C16H17F3N2 — CID 170212771
4-N-[3-[4-(trifluoromethyl)phenyl]propyl]benzene-1,4-diamine (PubChem CID 170212771) has the molecular formula C16H17F3N2 and a molecular weight of 294.32 g/mol. Its IUPAC name is 4-N-[3-[4-(trifluoromethyl)phenyl]propyl]benzene-1,4-diamine.
| Compound Name | 4-N-[3-[4-(trifluoromethyl)phenyl]propyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 170212771 |
| Molecular Formula | C16H17F3N2 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 4-N-[3-[4-(trifluoromethyl)phenyl]propyl]benzene-1,4-diamine |
| SMILES | Nc1ccc(NCCCc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H17F3N2/c17-16(18,19)13-5-3-12(4-6-13)2-1-11-21-15-9-7-14(20)8-10-15/h3-10,21H,1-2,11,20H2 |
| InChIKey | AVTBIQQUSLDRQK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|