C33H32F6N2 — CID 139935965
4-[3-[4-[2-[4-[3-(4-aminophenyl)propyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]propyl]aniline (PubChem CID 139935965) has the molecular formula C33H32F6N2 and a molecular weight of 570.62 g/mol. Its IUPAC name is 4-[3-[4-[2-[4-[3-(4-aminophenyl)propyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]propyl]aniline.
| Compound Name | 4-[3-[4-[2-[4-[3-(4-aminophenyl)propyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]propyl]aniline |
|---|---|
| PubChem CID | 139935965 |
| Molecular Formula | C33H32F6N2 |
| Molecular Weight | 570.62 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | 4-[3-[4-[2-[4-[3-(4-aminophenyl)propyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]propyl]aniline |
| SMILES | Nc1ccc(CCCc2ccc(C(c3ccc(CCCc4ccc(N)cc4)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C33H32F6N2/c34-32(35,36)31(33(37,38)39,27-15-7-23(8-16-27)3-1-5-25-11-19-29(40)20-12-25)28-17-9-24(10-18-28)4-2-6-26-13-21-30(41)22-14-26/h7-22H,1-6,40-41H2 |
| InChIKey | DLQRXQDRBQNNRA-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.62 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|