C30H34N4 — CID 174927585
4-[5,5,6-tris(4-aminophenyl)hexyl]aniline (PubChem CID 174927585) has the molecular formula C30H34N4 and a molecular weight of 450.63 g/mol. Its IUPAC name is 4-[5,5,6-tris(4-aminophenyl)hexyl]aniline.
| Compound Name | 4-[5,5,6-tris(4-aminophenyl)hexyl]aniline |
|---|---|
| PubChem CID | 174927585 |
| Molecular Formula | C30H34N4 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | 4-[5,5,6-tris(4-aminophenyl)hexyl]aniline |
| SMILES | Nc1ccc(CCCCC(Cc2ccc(N)cc2)(c2ccc(N)cc2)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C30H34N4/c31-26-12-4-22(5-13-26)3-1-2-20-30(24-8-16-28(33)17-9-24,25-10-18-29(34)19-11-25)21-23-6-14-27(32)15-7-23/h4-19H,1-3,20-21,31-34H2 |
| InChIKey | QVDSIVCOCGYWJI-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|