C34H24F16N2 — CID 142669913
4-[[4-[3-[4-[(4-aminophenyl)methyl]phenyl]-1,1,1,2,2,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctan-3-yl]phenyl]methyl]aniline (PubChem CID 142669913) has the molecular formula C34H24F16N2 and a molecular weight of 764.55 g/mol. Its IUPAC name is 4-[[4-[3-[4-[(4-aminophenyl)methyl]phenyl]-1,1,1,2,2,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctan-3-yl]phenyl]methyl]aniline.
| Compound Name | 4-[[4-[3-[4-[(4-aminophenyl)methyl]phenyl]-1,1,1,2,2,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctan-3-yl]phenyl]methyl]aniline |
|---|---|
| PubChem CID | 142669913 |
| Molecular Formula | C34H24F16N2 |
| Molecular Weight | 764.55 g/mol |
| Exact Mass | 764.17 |
| IUPAC Name | 4-[[4-[3-[4-[(4-aminophenyl)methyl]phenyl]-1,1,1,2,2,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctan-3-yl]phenyl]methyl]aniline |
| SMILES | Nc1ccc(Cc2ccc(C(c3ccc(Cc4ccc(N)cc4)cc3)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C34H24F16N2/c35-28(36,30(39,40)31(41,42)32(43,44)34(48,49)50)27(29(37,38)33(45,46)47,23-9-1-19(2-10-23)17-21-5-13-25(51)14-6-21)24-11-3-20(4-12-24)18-22-7-15-26(52)16-8-22/h1-16H,17-18,51-52H2 |
| InChIKey | KKSFMKUPTIFDTR-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.55 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|