C17H10F10O2 — CID 154343948
4-[1,1,1,2,2,4,4,5,5,5-decafluoro-3-(4-hydroxyphenyl)pentan-3-yl]phenol (PubChem CID 154343948) has the molecular formula C17H10F10O2 and a molecular weight of 436.25 g/mol. Its IUPAC name is 4-[1,1,1,2,2,4,4,5,5,5-decafluoro-3-(4-hydroxyphenyl)pentan-3-yl]phenol.
| Compound Name | 4-[1,1,1,2,2,4,4,5,5,5-decafluoro-3-(4-hydroxyphenyl)pentan-3-yl]phenol |
|---|---|
| PubChem CID | 154343948 |
| Molecular Formula | C17H10F10O2 |
| Molecular Weight | 436.25 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 4-[1,1,1,2,2,4,4,5,5,5-decafluoro-3-(4-hydroxyphenyl)pentan-3-yl]phenol |
| SMILES | Oc1ccc(C(c2ccc(O)cc2)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H10F10O2/c18-14(19,16(22,23)24)13(15(20,21)17(25,26)27,9-1-5-11(28)6-2-9)10-3-7-12(29)8-4-10/h1-8,28-29H |
| InChIKey | KXRGDUZAFUZUSM-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.25 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|