C11H8F6O — CID 22765164
4-(1,1,2,2,3,3-hexafluoropent-4-enyl)phenol (PubChem CID 22765164) has the molecular formula C11H8F6O and a molecular weight of 270.17 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3-hexafluoropent-4-enyl)phenol.
| Compound Name | 4-(1,1,2,2,3,3-hexafluoropent-4-enyl)phenol |
|---|---|
| PubChem CID | 22765164 |
| Molecular Formula | C11H8F6O |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 4-(1,1,2,2,3,3-hexafluoropent-4-enyl)phenol |
| SMILES | C=CC(F)(F)C(F)(F)C(F)(F)c1ccc(O)cc1 |
| InChI | InChI=1S/C11H8F6O/c1-2-9(12,13)11(16,17)10(14,15)7-3-5-8(18)6-4-7/h2-6,18H,1H2 |
| InChIKey | IKNCCMUEMRSRJC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|