C15H10ClF5O2 — CID 19850971
4-[1-chloro-1,1,3,3,3-pentafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol (PubChem CID 19850971) has the molecular formula C15H10ClF5O2 and a molecular weight of 352.69 g/mol. Its IUPAC name is 4-[1-chloro-1,1,3,3,3-pentafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol.
| Compound Name | 4-[1-chloro-1,1,3,3,3-pentafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol |
|---|---|
| PubChem CID | 19850971 |
| Molecular Formula | C15H10ClF5O2 |
| Molecular Weight | 352.69 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 4-[1-chloro-1,1,3,3,3-pentafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol |
| SMILES | Oc1ccc(C(c2ccc(O)cc2)(C(F)(F)F)C(F)(F)Cl)cc1 |
| InChI | InChI=1S/C15H10ClF5O2/c16-14(17,18)13(15(19,20)21,9-1-5-11(22)6-2-9)10-3-7-12(23)8-4-10/h1-8,22-23H |
| InChIKey | QIRFFFNXQCEPKL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.69 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|