C33H24F12O5 — CID 159467125
4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol;[4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]phenyl] acetate (PubChem CID 159467125) has the molecular formula C33H24F12O5 and a molecular weight of 728.53 g/mol. Its IUPAC name is 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol;[4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]phenyl] acetate.
| Compound Name | 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol;[4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 159467125 |
| Molecular Formula | C33H24F12O5 |
| Molecular Weight | 728.53 g/mol |
| Exact Mass | 728.14 |
| IUPAC Name | 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol;[4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]phenyl] acetate |
| SMILES | COc1ccc(C(c2ccc(OC(C)=O)cc2)(C(F)(F)F)C(F)(F)F)cc1.Oc1ccc(C(c2ccc(O)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H14F6O3.C15H10F6O2/c1-11(25)27-15-9-5-13(6-10-15)16(17(19,20)21,18(22,23)24)12-3-7-14(26-2)8-4-12;16-14(17,18)13(15(19,20)21,9-1-5-11(22)6-2-9)10-3-7-12(23)8-4-10/h3-10H,1-2H3;1-8,22-23H |
| InChIKey | LVIGJSSMFQILSA-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.53 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|