C23H14F6O4 — CID 88952563
[4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenyl] 4-formylbenzoate (PubChem CID 88952563) has the molecular formula C23H14F6O4 and a molecular weight of 468.35 g/mol. Its IUPAC name is [4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenyl] 4-formylbenzoate.
| Compound Name | [4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenyl] 4-formylbenzoate |
|---|---|
| PubChem CID | 88952563 |
| Molecular Formula | C23H14F6O4 |
| Molecular Weight | 468.35 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | [4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenyl] 4-formylbenzoate |
| SMILES | O=Cc1ccc(C(=O)Oc2ccc(C(c3ccc(O)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H14F6O4/c24-22(25,26)21(23(27,28)29,16-5-9-18(31)10-6-16)17-7-11-19(12-8-17)33-20(32)15-3-1-14(13-30)2-4-15/h1-13,31H |
| InChIKey | MJMGOCOPYPLMHY-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.35 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|