C35H24F18N2 — CID 142669911
4-[[4-[5-[4-[(4-aminophenyl)methyl]phenyl]-1,1,1,2,2,3,3,4,4,6,6,7,7,8,8,9,9,9-octadecafluorononan-5-yl]phenyl]methyl]aniline (PubChem CID 142669911) has the molecular formula C35H24F18N2 and a molecular weight of 814.55 g/mol. Its IUPAC name is 4-[[4-[5-[4-[(4-aminophenyl)methyl]phenyl]-1,1,1,2,2,3,3,4,4,6,6,7,7,8,8,9,9,9-octadecafluorononan-5-yl]phenyl]methyl]aniline.
| Compound Name | 4-[[4-[5-[4-[(4-aminophenyl)methyl]phenyl]-1,1,1,2,2,3,3,4,4,6,6,7,7,8,8,9,9,9-octadecafluorononan-5-yl]phenyl]methyl]aniline |
|---|---|
| PubChem CID | 142669911 |
| Molecular Formula | C35H24F18N2 |
| Molecular Weight | 814.55 g/mol |
| Exact Mass | 814.17 |
| IUPAC Name | 4-[[4-[5-[4-[(4-aminophenyl)methyl]phenyl]-1,1,1,2,2,3,3,4,4,6,6,7,7,8,8,9,9,9-octadecafluorononan-5-yl]phenyl]methyl]aniline |
| SMILES | Nc1ccc(Cc2ccc(C(c3ccc(Cc4ccc(N)cc4)cc3)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C35H24F18N2/c36-28(37,30(40,41)32(44,45)34(48,49)50)27(29(38,39)31(42,43)33(46,47)35(51,52)53,23-9-1-19(2-10-23)17-21-5-13-25(54)14-6-21)24-11-3-20(4-12-24)18-22-7-15-26(55)16-8-22/h1-16H,17-18,54-55H2 |
| InChIKey | QVSXEQVTKOTEQE-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.55 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|