C56H60N8 — CID 70271319
4-[(4-aminophenyl)methyl]aniline;4-[1,4,4,7,7-pentakis(4-aminophenyl)heptyl]aniline (PubChem CID 70271319) has the molecular formula C56H60N8 and a molecular weight of 845.15 g/mol. Its IUPAC name is 4-[(4-aminophenyl)methyl]aniline;4-[1,4,4,7,7-pentakis(4-aminophenyl)heptyl]aniline.
| Compound Name | 4-[(4-aminophenyl)methyl]aniline;4-[1,4,4,7,7-pentakis(4-aminophenyl)heptyl]aniline |
|---|---|
| PubChem CID | 70271319 |
| Molecular Formula | C56H60N8 |
| Molecular Weight | 845.15 g/mol |
| Exact Mass | 844.49 |
| IUPAC Name | 4-[(4-aminophenyl)methyl]aniline;4-[1,4,4,7,7-pentakis(4-aminophenyl)heptyl]aniline |
| SMILES | Nc1ccc(C(CCC(CCC(c2ccc(N)cc2)c2ccc(N)cc2)(c2ccc(N)cc2)c2ccc(N)cc2)c2ccc(N)cc2)cc1.Nc1ccc(Cc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C43H46N6.C13H14N2/c44-35-13-1-29(2-14-35)41(30-3-15-36(45)16-4-30)25-27-43(33-9-21-39(48)22-10-33,34-11-23-40(49)24-12-34)28-26-42(31-5-17-37(46)18-6-31)32-7-19-38(47)20-8-32;14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11/h1-24,41-42H,25-28,44-49H2;1-8H,9,14-15H2 |
| InChIKey | FJENKMWDBSOWQG-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 208.16 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.15 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|