C12H17F3N2 — CID 62648258
N',N'-dimethyl-N-[4-(trifluoromethyl)phenyl]propane-1,3-diamine (PubChem CID 62648258) has the molecular formula C12H17F3N2 and a molecular weight of 246.28 g/mol. Its IUPAC name is N',N'-dimethyl-N-[4-(trifluoromethyl)phenyl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[4-(trifluoromethyl)phenyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 62648258 |
| Molecular Formula | C12H17F3N2 |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | N',N'-dimethyl-N-[4-(trifluoromethyl)phenyl]propane-1,3-diamine |
| SMILES | CN(C)CCCNc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H17F3N2/c1-17(2)9-3-8-16-11-6-4-10(5-7-11)12(13,14)15/h4-7,16H,3,8-9H2,1-2H3 |
| InChIKey | WLGXJAIIFYWOJM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|