C9H21N3O2S — CID 43603509
N-(2-aminoethyl)-3,5-dimethylpiperidine-1-sulfonamide (PubChem CID 43603509) has the molecular formula C9H21N3O2S and a molecular weight of 235.35 g/mol. Its IUPAC name is N-(2-aminoethyl)-3,5-dimethylpiperidine-1-sulfonamide.
| Compound Name | N-(2-aminoethyl)-3,5-dimethylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 43603509 |
| Molecular Formula | C9H21N3O2S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | N-(2-aminoethyl)-3,5-dimethylpiperidine-1-sulfonamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)NCCN)C1 |
| InChI | InChI=1S/C9H21N3O2S/c1-8-5-9(2)7-12(6-8)15(13,14)11-4-3-10/h8-9,11H,3-7,10H2,1-2H3 |
| InChIKey | FIEFAJWWWYBILQ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |