C10H24ClN3O2S — CID 119973056
3,5-dimethyl-N-[2-(methylamino)ethyl]piperidine-1-sulfonamide;hydrochloride (PubChem CID 119973056) has the molecular formula C10H24ClN3O2S and a molecular weight of 285.84 g/mol. Its IUPAC name is 3,5-dimethyl-N-[2-(methylamino)ethyl]piperidine-1-sulfonamide;hydrochloride.
| Compound Name | 3,5-dimethyl-N-[2-(methylamino)ethyl]piperidine-1-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119973056 |
| Molecular Formula | C10H24ClN3O2S |
| Molecular Weight | 285.84 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 3,5-dimethyl-N-[2-(methylamino)ethyl]piperidine-1-sulfonamide;hydrochloride |
| SMILES | CNCCNS(=O)(=O)N1CC(C)CC(C)C1.Cl |
| InChI | InChI=1S/C10H23N3O2S.ClH/c1-9-6-10(2)8-13(7-9)16(14,15)12-5-4-11-3;/h9-12H,4-8H2,1-3H3;1H |
| InChIKey | VAPWRSSCASSRFK-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.84 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|