C16H32N2O3S — CID 52530156
(3S,5R)-3,5-dimethyl-N-[2-[(1S,2S)-2-methylcyclohexyl]oxyethyl]piperidine-1-sulfonamide (PubChem CID 52530156) has the molecular formula C16H32N2O3S and a molecular weight of 332.51 g/mol. Its IUPAC name is (3S,5R)-3,5-dimethyl-N-[2-[(1S,2S)-2-methylcyclohexyl]oxyethyl]piperidine-1-sulfonamide.
| Compound Name | (3S,5R)-3,5-dimethyl-N-[2-[(1S,2S)-2-methylcyclohexyl]oxyethyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 52530156 |
| Molecular Formula | C16H32N2O3S |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | (3S,5R)-3,5-dimethyl-N-[2-[(1S,2S)-2-methylcyclohexyl]oxyethyl]piperidine-1-sulfonamide |
| SMILES | C[C@@H]1C[C@H](C)CN(S(=O)(=O)NCCO[C@H]2CCCC[C@@H]2C)C1 |
| InChI | InChI=1S/C16H32N2O3S/c1-13-10-14(2)12-18(11-13)22(19,20)17-8-9-21-16-7-5-4-6-15(16)3/h13-17H,4-12H2,1-3H3/t13-,14+,15-,16-/m0/s1 |
| InChIKey | JUEJAEIYIVEIJB-FZKCQIBNSA-N |
| XLogP | 2.39 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|