C15H29N3O4S — CID 94824406
N-[2-[(1R,2S)-2-methylcyclohexyl]oxyethyl]-1-sulfamoylpiperidine-4-carboxamide (PubChem CID 94824406) has the molecular formula C15H29N3O4S and a molecular weight of 347.48 g/mol. Its IUPAC name is N-[2-[(1R,2S)-2-methylcyclohexyl]oxyethyl]-1-sulfamoylpiperidine-4-carboxamide.
| Compound Name | N-[2-[(1R,2S)-2-methylcyclohexyl]oxyethyl]-1-sulfamoylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 94824406 |
| Molecular Formula | C15H29N3O4S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | N-[2-[(1R,2S)-2-methylcyclohexyl]oxyethyl]-1-sulfamoylpiperidine-4-carboxamide |
| SMILES | C[C@H]1CCCC[C@H]1OCCNC(=O)C1CCN(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C15H29N3O4S/c1-12-4-2-3-5-14(12)22-11-8-17-15(19)13-6-9-18(10-7-13)23(16,20)21/h12-14H,2-11H2,1H3,(H,17,19)(H2,16,20,21)/t12-,14+/m0/s1 |
| InChIKey | UCHABKUPFZLERG-GXTWGEPZSA-N |
| XLogP | 0.61 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|