C16H30N2O4S — CID 94026393
(2S)-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-methylsulfonylpiperidine-2-carboxamide (PubChem CID 94026393) has the molecular formula C16H30N2O4S and a molecular weight of 346.49 g/mol. Its IUPAC name is (2S)-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-methylsulfonylpiperidine-2-carboxamide.
| Compound Name | (2S)-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-methylsulfonylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 94026393 |
| Molecular Formula | C16H30N2O4S |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (2S)-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-methylsulfonylpiperidine-2-carboxamide |
| SMILES | C[C@@H]1CCCC[C@H]1OCCNC(=O)[C@@H]1CCCCN1S(C)(=O)=O |
| InChI | InChI=1S/C16H30N2O4S/c1-13-7-3-4-9-15(13)22-12-10-17-16(19)14-8-5-6-11-18(14)23(2,20)21/h13-15H,3-12H2,1-2H3,(H,17,19)/t13-,14+,15-/m1/s1 |
| InChIKey | AXFFIYZNNIIAAD-QLFBSQMISA-N |
| XLogP | 1.51 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|