C14H26N2O2 — CID 52657662
N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]pyrrolidine-1-carboxamide (PubChem CID 52657662) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 52657662 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]pyrrolidine-1-carboxamide |
| SMILES | C[C@@H]1CCCC[C@H]1OCCNC(=O)N1CCCC1 |
| InChI | InChI=1S/C14H26N2O2/c1-12-6-2-3-7-13(12)18-11-8-15-14(17)16-9-4-5-10-16/h12-13H,2-11H2,1H3,(H,15,17)/t12-,13-/m1/s1 |
| InChIKey | CFKVBHPLWVBFRE-CHWSQXEVSA-N |
| XLogP | 2.39 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|