C20H36N4O3 — CID 119131756
N'-methyl-N-[2-(2-methylcyclohexyl)oxyethyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 119131756) has the molecular formula C20H36N4O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is N'-methyl-N-[2-(2-methylcyclohexyl)oxyethyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[2-(2-methylcyclohexyl)oxyethyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119131756 |
| Molecular Formula | C20H36N4O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | N'-methyl-N-[2-(2-methylcyclohexyl)oxyethyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCOC1CCCCC1C)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C20H36N4O3/c1-16-6-3-4-7-17(16)27-15-9-22-20(21-2)24-12-10-23(11-13-24)19(25)18-8-5-14-26-18/h16-18H,3-15H2,1-2H3,(H,21,22) |
| InChIKey | ZOJGYIDWBHUXMT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|