C18H28ClN3O4S2 — CID 55809091
4-(5-chlorothiophen-2-yl)sulfonyl-N-[2-(2-methylcyclohexyl)oxyethyl]piperazine-1-carboxamide (PubChem CID 55809091) has the molecular formula C18H28ClN3O4S2 and a molecular weight of 450.03 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)sulfonyl-N-[2-(2-methylcyclohexyl)oxyethyl]piperazine-1-carboxamide.
| Compound Name | 4-(5-chlorothiophen-2-yl)sulfonyl-N-[2-(2-methylcyclohexyl)oxyethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55809091 |
| Molecular Formula | C18H28ClN3O4S2 |
| Molecular Weight | 450.03 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)sulfonyl-N-[2-(2-methylcyclohexyl)oxyethyl]piperazine-1-carboxamide |
| SMILES | CC1CCCCC1OCCNC(=O)N1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C18H28ClN3O4S2/c1-14-4-2-3-5-15(14)26-13-8-20-18(23)21-9-11-22(12-10-21)28(24,25)17-7-6-16(19)27-17/h6-7,14-15H,2-5,8-13H2,1H3,(H,20,23) |
| InChIKey | MELPPMQWSJMSJE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.03 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|