C13H20ClN3O3S3 — CID 55353568
4-(5-chlorothiophen-2-yl)sulfonyl-N-(3-methoxypropyl)piperazine-1-carbothioamide (PubChem CID 55353568) has the molecular formula C13H20ClN3O3S3 and a molecular weight of 397.98 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)sulfonyl-N-(3-methoxypropyl)piperazine-1-carbothioamide.
| Compound Name | 4-(5-chlorothiophen-2-yl)sulfonyl-N-(3-methoxypropyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 55353568 |
| Molecular Formula | C13H20ClN3O3S3 |
| Molecular Weight | 397.98 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)sulfonyl-N-(3-methoxypropyl)piperazine-1-carbothioamide |
| SMILES | COCCCNC(=S)N1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C13H20ClN3O3S3/c1-20-10-2-5-15-13(21)16-6-8-17(9-7-16)23(18,19)12-4-3-11(14)22-12/h3-4H,2,5-10H2,1H3,(H,15,21) |
| InChIKey | YXGOBRLVYYBCHW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.98 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|