C15H28N2O2S — CID 96555189
N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1,4-thiazepane-4-carboxamide (PubChem CID 96555189) has the molecular formula C15H28N2O2S and a molecular weight of 300.47 g/mol. Its IUPAC name is N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1,4-thiazepane-4-carboxamide.
| Compound Name | N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 96555189 |
| Molecular Formula | C15H28N2O2S |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1,4-thiazepane-4-carboxamide |
| SMILES | C[C@@H]1CCCC[C@H]1OCCNC(=O)N1CCCSCC1 |
| InChI | InChI=1S/C15H28N2O2S/c1-13-5-2-3-6-14(13)19-10-7-16-15(18)17-8-4-11-20-12-9-17/h13-14H,2-12H2,1H3,(H,16,18)/t13-,14-/m1/s1 |
| InChIKey | RVKFVVIYQCHSJV-ZIAGYGMSSA-N |
| XLogP | 2.73 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|