C24H37N3O5 — CID 52522274
1-[4,5-dimethoxy-2-(piperidine-1-carbonyl)phenyl]-3-[2-[(1S,2S)-2-methylcyclohexyl]oxyethyl]urea (PubChem CID 52522274) has the molecular formula C24H37N3O5 and a molecular weight of 447.58 g/mol. Its IUPAC name is 1-[4,5-dimethoxy-2-(piperidine-1-carbonyl)phenyl]-3-[2-[(1S,2S)-2-methylcyclohexyl]oxyethyl]urea.
| Compound Name | 1-[4,5-dimethoxy-2-(piperidine-1-carbonyl)phenyl]-3-[2-[(1S,2S)-2-methylcyclohexyl]oxyethyl]urea |
|---|---|
| PubChem CID | 52522274 |
| Molecular Formula | C24H37N3O5 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | 1-[4,5-dimethoxy-2-(piperidine-1-carbonyl)phenyl]-3-[2-[(1S,2S)-2-methylcyclohexyl]oxyethyl]urea |
| SMILES | COc1cc(NC(=O)NCCO[C@H]2CCCC[C@@H]2C)c(C(=O)N2CCCCC2)cc1OC |
| InChI | InChI=1S/C24H37N3O5/c1-17-9-5-6-10-20(17)32-14-11-25-24(29)26-19-16-22(31-3)21(30-2)15-18(19)23(28)27-12-7-4-8-13-27/h15-17,20H,4-14H2,1-3H3,(H2,25,26,29)/t17-,20-/m0/s1 |
| InChIKey | OQTCRJZXQTYBEZ-PXNSSMCTSA-N |
| XLogP | 4.05 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|