C21H32N2O5 — CID 48658025
2-butoxy-N-[4,5-dimethoxy-2-(piperidine-1-carbonyl)phenyl]propanamide (PubChem CID 48658025) has the molecular formula C21H32N2O5 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-butoxy-N-[4,5-dimethoxy-2-(piperidine-1-carbonyl)phenyl]propanamide.
| Compound Name | 2-butoxy-N-[4,5-dimethoxy-2-(piperidine-1-carbonyl)phenyl]propanamide |
|---|---|
| PubChem CID | 48658025 |
| Molecular Formula | C21H32N2O5 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 2-butoxy-N-[4,5-dimethoxy-2-(piperidine-1-carbonyl)phenyl]propanamide |
| SMILES | CCCCOC(C)C(=O)Nc1cc(OC)c(OC)cc1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C21H32N2O5/c1-5-6-12-28-15(2)20(24)22-17-14-19(27-4)18(26-3)13-16(17)21(25)23-10-8-7-9-11-23/h13-15H,5-12H2,1-4H3,(H,22,24) |
| InChIKey | HDUZPSQTGXRGHR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|