C22H33N3O3 — CID 94080028
1-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-3-[3-methyl-2-(pyrrolidine-1-carbonyl)phenyl]urea (PubChem CID 94080028) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is 1-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-3-[3-methyl-2-(pyrrolidine-1-carbonyl)phenyl]urea.
| Compound Name | 1-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-3-[3-methyl-2-(pyrrolidine-1-carbonyl)phenyl]urea |
|---|---|
| PubChem CID | 94080028 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | 1-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-3-[3-methyl-2-(pyrrolidine-1-carbonyl)phenyl]urea |
| SMILES | Cc1cccc(NC(=O)NCCO[C@H]2CCCC[C@H]2C)c1C(=O)N1CCCC1 |
| InChI | InChI=1S/C22H33N3O3/c1-16-8-3-4-11-19(16)28-15-12-23-22(27)24-18-10-7-9-17(2)20(18)21(26)25-13-5-6-14-25/h7,9-10,16,19H,3-6,8,11-15H2,1-2H3,(H2,23,24,27)/t16-,19+/m1/s1 |
| InChIKey | VZCIACGFACLEGY-APWZRJJASA-N |
| XLogP | 3.95 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|