C22H35N3O3 — CID 98723402
1-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]phenyl]-3-[2-[(1R,2S)-2-methylcyclohexyl]oxyethyl]urea (PubChem CID 98723402) has the molecular formula C22H35N3O3 and a molecular weight of 389.54 g/mol. Its IUPAC name is 1-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]phenyl]-3-[2-[(1R,2S)-2-methylcyclohexyl]oxyethyl]urea.
| Compound Name | 1-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]phenyl]-3-[2-[(1R,2S)-2-methylcyclohexyl]oxyethyl]urea |
|---|---|
| PubChem CID | 98723402 |
| Molecular Formula | C22H35N3O3 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | 1-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]phenyl]-3-[2-[(1R,2S)-2-methylcyclohexyl]oxyethyl]urea |
| SMILES | C[C@@H]1CN(c2ccccc2NC(=O)NCCO[C@@H]2CCCC[C@@H]2C)C[C@@H](C)O1 |
| InChI | InChI=1S/C22H35N3O3/c1-16-8-4-7-11-21(16)27-13-12-23-22(26)24-19-9-5-6-10-20(19)25-14-17(2)28-18(3)15-25/h5-6,9-10,16-18,21H,4,7-8,11-15H2,1-3H3,(H2,23,24,26)/t16-,17+,18+,21+/m0/s1 |
| InChIKey | SQAPZLAFBPKJMK-XKGFGPFHSA-N |
| XLogP | 4.02 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|