C19H23N3O3 — CID 124618726
1-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-3-(4-hydroxyphenyl)urea (PubChem CID 124618726) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-3-(4-hydroxyphenyl)urea.
| Compound Name | 1-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-3-(4-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 124618726 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 1-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-3-(4-hydroxyphenyl)urea |
| SMILES | C[C@H]1CN(c2ccccc2NC(=O)Nc2ccc(O)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C19H23N3O3/c1-13-11-22(12-14(2)25-13)18-6-4-3-5-17(18)21-19(24)20-15-7-9-16(23)10-8-15/h3-10,13-14,23H,11-12H2,1-2H3,(H2,20,21,24)/t13-,14-/m0/s1 |
| InChIKey | QEIWWDMULXXFOS-KBPBESRZSA-N |
| XLogP | 3.65 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|