C21H27N3O3 — CID 94154697
3-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-1-[(2-hydroxyphenyl)methyl]-1-methylurea (PubChem CID 94154697) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 3-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-1-[(2-hydroxyphenyl)methyl]-1-methylurea.
| Compound Name | 3-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-1-[(2-hydroxyphenyl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 94154697 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 3-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-1-[(2-hydroxyphenyl)methyl]-1-methylurea |
| SMILES | C[C@@H]1CN(c2ccccc2NC(=O)N(C)Cc2ccccc2O)C[C@H](C)O1 |
| InChI | InChI=1S/C21H27N3O3/c1-15-12-24(13-16(2)27-15)19-10-6-5-9-18(19)22-21(26)23(3)14-17-8-4-7-11-20(17)25/h4-11,15-16,25H,12-14H2,1-3H3,(H,22,26)/t15-,16+ |
| InChIKey | VRDRHNMRTAXHPW-IYBDPMFKSA-N |
| XLogP | 3.67 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|