C20H32N2O2 — CID 86901306
N-[2-(2,6-dimethylmorpholin-4-yl)phenyl]-3,4,4-trimethylpentanamide (PubChem CID 86901306) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is N-[2-(2,6-dimethylmorpholin-4-yl)phenyl]-3,4,4-trimethylpentanamide.
| Compound Name | N-[2-(2,6-dimethylmorpholin-4-yl)phenyl]-3,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 86901306 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | N-[2-(2,6-dimethylmorpholin-4-yl)phenyl]-3,4,4-trimethylpentanamide |
| SMILES | CC1CN(c2ccccc2NC(=O)CC(C)C(C)(C)C)CC(C)O1 |
| InChI | InChI=1S/C20H32N2O2/c1-14(20(4,5)6)11-19(23)21-17-9-7-8-10-18(17)22-12-15(2)24-16(3)13-22/h7-10,14-16H,11-13H2,1-6H3,(H,21,23) |
| InChIKey | IUFCGVUALOOWRK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |