C17H25N3O4 — CID 94444100
N'-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]-N-[(2R)-2-hydroxypropyl]oxamide (PubChem CID 94444100) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is N'-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]-N-[(2R)-2-hydroxypropyl]oxamide.
| Compound Name | N'-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]-N-[(2R)-2-hydroxypropyl]oxamide |
|---|---|
| PubChem CID | 94444100 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | N'-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]-N-[(2R)-2-hydroxypropyl]oxamide |
| SMILES | C[C@@H]1CN(c2ccccc2NC(=O)C(=O)NC[C@@H](C)O)C[C@H](C)O1 |
| InChI | InChI=1S/C17H25N3O4/c1-11(21)8-18-16(22)17(23)19-14-6-4-5-7-15(14)20-9-12(2)24-13(3)10-20/h4-7,11-13,21H,8-10H2,1-3H3,(H,18,22)(H,19,23)/t11-,12-,13+/m1/s1 |
| InChIKey | MQOAQMWDUKGURE-UPJWGTAASA-N |
| XLogP | 0.74 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|