C11H22N2OS — CID 86999010
N-(3-methylbutyl)-1,4-thiazepane-4-carboxamide (PubChem CID 86999010) has the molecular formula C11H22N2OS and a molecular weight of 230.38 g/mol. Its IUPAC name is N-(3-methylbutyl)-1,4-thiazepane-4-carboxamide.
| Compound Name | N-(3-methylbutyl)-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 86999010 |
| Molecular Formula | C11H22N2OS |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | N-(3-methylbutyl)-1,4-thiazepane-4-carboxamide |
| SMILES | CC(C)CCNC(=O)N1CCCSCC1 |
| InChI | InChI=1S/C11H22N2OS/c1-10(2)4-5-12-11(14)13-6-3-8-15-9-7-13/h10H,3-9H2,1-2H3,(H,12,14) |
| InChIKey | XPAUMDKTQZSRIQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |